cas: 39629-87-3 — see every product listed under this CAS number, including other names
1-(4-Chloro-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid, 95% (CAS 39629-87-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F028444-1G |
| cas | 39629-87-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1684.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 39629-87-3) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: QPYOMMCYFFZXIT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | QPYOMMCYFFZXIT-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)