cas: 39629-87-3 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid, ≥95%, ≥95% (CAS 39629-87-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYN2-50mg |
| cas | 39629-87-3 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 150.80 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 894.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 39629-87-3) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: QPYOMMCYFFZXIT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | QPYOMMCYFFZXIT-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)