CAS 39629-87-3 appears in our catalog under these names: 1-(4-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 98%, 1-(4-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 50mg, 250mg.
1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 39629-87-3) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: QPYOMMCYFFZXIT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | QPYOMMCYFFZXIT-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)