cas: 71573-93-8 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-3-methyl-1-butanone, ≥97-<99% (CAS 71573-93-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC2719-97-99-1g |
| cas | 71573-93-8 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 4793.14 Pln | |
| Hoffman Fine Chemicals | 2,5g | 8161.78 Pln | |
| Hoffman Fine Chemicals | 5g | 10037.50 Pln | |
| Hoffman Fine Chemicals | 10g | 15875.20 Pln | |
| Hoffman Fine Chemicals | 25g | 33394.68 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-(4-chlorophenyl)-3-methylbutan-1-one (CAS 71573-93-8) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-methylbutan-1-one. InChIKey: SCNNXOZSXWBSSI-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-methylbutan-1-one |
| InChIKey | SCNNXOZSXWBSSI-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)