CAS 735321-29-6 is the registry number for 2-Chloro-1-(3,4-dimethyl-phenyl)-propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-1-(3,4-dimethylphenyl)propan-1-one (CAS 735321-29-6) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 2-chloro-1-(3,4-dimethylphenyl)propan-1-one. InChIKey: DCNJHKGGMWFXTB-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-chloro-1-(3,4-dimethylphenyl)propan-1-one |
| InChIKey | DCNJHKGGMWFXTB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(C)Cl)C |
Computed by PubChem (NCBI)