CAS 1184000-15-4 is the registry number for 3'-Chloro-3-methylbutyrophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3-chlorophenyl)-3-methylbutan-1-one (CAS 1184000-15-4) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 1-(3-chlorophenyl)-3-methylbutan-1-one. InChIKey: YEWVALCFNNINPK-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-3-methylbutan-1-one |
| InChIKey | YEWVALCFNNINPK-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)