CAS 65248-53-5 appears in our catalog under these names: 1-(4-Chlorophenyl)-3-methylbutan-2-one, 95%, 1-(4-Chlorophenyl)-3-methylbutan-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
1-(4-chlorophenyl)-3-methylbutan-2-one (CAS 65248-53-5) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-methylbutan-2-one. InChIKey: AMBVFARIMNOUMI-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-methylbutan-2-one |
| InChIKey | AMBVFARIMNOUMI-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)CC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)