CAS 30314-42-2 appears in our catalog under these names: 1-(4-Chlorophenyl)-2,2-dimethylpropan-1-one, 95%, 1-(4-Chlorophenyl)-2,2-dimethylpropan-1-one, 97%, 4'-Chloro-2,2-dimethylpropiophenone, 1-(4-Chlorophenyl)-2,2-dimethylpropan-1-one, 97%, 97%, 4'-Chloro-2,2-dimethylpropiophenone, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg, 2,5g.
1-(4-chlorophenyl)-2,2-dimethylpropan-1-one (CAS 30314-42-2) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,2-dimethylpropan-1-one. InChIKey: DKFLDXIDGFZMCL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,2-dimethylpropan-1-one |
| InChIKey | DKFLDXIDGFZMCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)