CAS 88632-72-8 appears in our catalog under these names: 2-Chloro-1-(2,5-dimethyl-phenyl)-propan-1-one, 95%, 2-Chloro-1-(2,5-dimethylphenyl)propan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-chloro-1-(2,5-dimethylphenyl)propan-1-one (CAS 88632-72-8) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: 2-chloro-1-(2,5-dimethylphenyl)propan-1-one. InChIKey: WJDFCWSMCKCWEU-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-chloro-1-(2,5-dimethylphenyl)propan-1-one |
| InChIKey | WJDFCWSMCKCWEU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)C(C)Cl |
Computed by PubChem (NCBI)