1-(4-Chlorophenyl)-5-methylimidazolidine-2,4-dione, 95%
cas: 1008068-93-6 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-5-methylimidazolidine-2,4-dione, 95% (CAS 1008068-93-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1063986-250mg |
| cas | 1008068-93-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 604.00 Pln | |
| Ambeed | 5g | 2155.94 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 647.57 Pln | |
| BLDpharm | 5g | 2319.21 Pln | |
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 741.20 Pln | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 586.27 Pln | |
| Fluorochem | 1g | 1372.45 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione (CAS 1008068-93-6) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: YRTFBBSKIRZNAW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | YRTFBBSKIRZNAW-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC(=O)N1C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)