CAS 1823330-95-5 is the registry number for Ethyl 8-chloroimidazo[1,2-a]pyridine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
Ethyl 8-chloroimidazo[1,2-a]pyridine-6-carboxylate (CAS 1823330-95-5) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: ethyl 8-chloroimidazo[1,2-a]pyridine-6-carboxylate. InChIKey: OTIWIYFRQYZQNI-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | ethyl 8-chloroimidazo[1,2-a]pyridine-6-carboxylate |
| InChIKey | OTIWIYFRQYZQNI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=CN=C2C(=C1)Cl |
Computed by PubChem (NCBI)