CAS 73217-31-9 appears in our catalog under these names: 3-(Chloromethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole, 95%, 3-(Chloromethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 5g, 10g.
3-(chloromethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole (CAS 73217-31-9) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 3-(chloromethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole. InChIKey: LSYCZBSPYWGGHC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 3-(chloromethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | LSYCZBSPYWGGHC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=NO2)CCl |
Computed by PubChem (NCBI)