CAS 1352395-06-2 appears in our catalog under these names: 8-Chloro-imidazo[1,2-a]pyridine-2-carboxylic acid ethyl ester, 95%, Ethyl 8-chloroimidazo(1,2-a)pyridine-2-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Ethyl 8-chloroimidazo[1,2-a]pyridine-2-carboxylate (CAS 1352395-06-2) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: ethyl 8-chloroimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: MLQUBAHHPYDSQO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | ethyl 8-chloroimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | MLQUBAHHPYDSQO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=CC=C(C2=N1)Cl |
Computed by PubChem (NCBI)