CAS 70724-23-1 appears in our catalog under these names: 1–Chloro–6,7–dimethoxyphthalazine, 1-Chloro-6,7-dimethoxyphthalazine, 1-Chloro-6,7-dimethoxyphthalazine, 95%. Offered by: GLPBio, Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
1-chloro-6,7-dimethoxyphthalazine (CAS 70724-23-1) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 1-chloro-6,7-dimethoxyphthalazine. InChIKey: DSFKIBHRGIYRNZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 1-chloro-6,7-dimethoxyphthalazine |
| InChIKey | DSFKIBHRGIYRNZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=NN=C2Cl)OC |
Computed by PubChem (NCBI)