CAS 494779-10-1 appears in our catalog under these names: 3-(4-Chlorophenyl)-1,3-diazinane-2,4-dione, 95%, 3-(4-Chlorophenyl)-1,3-diazinane-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 50mg, 0,5g.
3-(4-chlorophenyl)-1,3-diazinane-2,4-dione (CAS 494779-10-1) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,3-diazinane-2,4-dione. InChIKey: DXMYOZMLGXFPAR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | DXMYOZMLGXFPAR-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)