cas: 6633-22-3 — see every product listed under this CAS number, including other names
1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione 98% (CAS 6633-22-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A295897-250mg |
| cas | 6633-22-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 1416.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A295897 |
1-(4-fluorophenyl)pyrrole-2,5-dione (CAS 6633-22-3) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrrole-2,5-dione. InChIKey: SBKKXWSZVVDOLR-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrrole-2,5-dione |
| InChIKey | SBKKXWSZVVDOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)F |
Computed by PubChem (NCBI)