cas: 185848-10-6 — see every product listed under this CAS number, including other names
1-(4-Methoxyphenyl)-2-(pyrimidin-4-yl)ethanol 95% (CAS 185848-10-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A311723-250mg |
| cas | 185848-10-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 286.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A311723 |
1-(4-methoxyphenyl)-2-pyrimidin-4-ylethanol (CAS 185848-10-6) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2-pyrimidin-4-ylethanol. InChIKey: NCDZMQADLRAVOK-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2-pyrimidin-4-ylethanol |
| InChIKey | NCDZMQADLRAVOK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(CC2=NC=NC=C2)O |
Computed by PubChem (NCBI)