cas: 185848-10-6 — see every product listed under this CAS number, including other names
1-(4-Methoxyphenyl)-2-pyrimidin-4-yl ethanol (CAS 185848-10-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023554-1G |
| cas | 185848-10-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1049.65 Pln | |
| Fluorochem | 10g | 1861.86 Pln | |
| Fluorochem | 25g | 3939.26 Pln |
| delivery time | 2-3 weeks |
|---|
1-(4-methoxyphenyl)-2-pyrimidin-4-ylethanol (CAS 185848-10-6) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2-pyrimidin-4-ylethanol. InChIKey: NCDZMQADLRAVOK-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2-pyrimidin-4-ylethanol |
| InChIKey | NCDZMQADLRAVOK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(CC2=NC=NC=C2)O |
Computed by PubChem (NCBI)