1-(4-Nitrophenyl)-1H-pyrazole, 97%
cas: 3463-30-7 — see every product listed under this CAS number, including other names
1-(4-Nitrophenyl)-1H-pyrazole, 97% (CAS 3463-30-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A280944-1g |
| cas | 3463-30-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 387.06 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 25g | 414.32 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 554.00 Pln | |
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 25g | 1013.20 Pln | |
| Fluorochem | 5g | 279.09 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-nitrophenyl)pyrazole (CAS 3463-30-7) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 1-(4-nitrophenyl)pyrazole. InChIKey: PNWPAZGIVRZAER-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-(4-nitrophenyl)pyrazole |
| InChIKey | PNWPAZGIVRZAER-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)