CAS 60467-74-5 is the registry number for 2-Oxo-1H-1,8-naphthyridine-3-carboxamide, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-oxo-1H-1,8-naphthyridine-3-carboxamide (CAS 60467-74-5) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 2-oxo-1H-1,8-naphthyridine-3-carboxamide. InChIKey: ZGPPMEADTREHRZ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-oxo-1H-1,8-naphthyridine-3-carboxamide |
| InChIKey | ZGPPMEADTREHRZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)C(=C2)C(=O)N)N=C1 |
Computed by PubChem (NCBI)