Products 216959-87-4
CAS 216959-87-4 appears in our catalog under these names: 4-(1,2,3-Triazol-1-yl)benzoic acid, 97%, 4–(1H–1，2，3–Triazol–1–yl)benzoic acid, 4-(1H-1,2,3-Triazol-1-yl)benzoic acid, 4-(1H-1,2,3-Triazol-1-yl)benzoic acid 98%, 4-(1H-1,2,3-Triazol-1-yl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
4-(triazol-1-yl)benzoic acid (CAS 216959-87-4) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 4-(triazol-1-yl)benzoic acid. InChIKey: JTHKCLWGWCRWRN-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-(triazol-1-yl)benzoic acid |
| InChIKey | JTHKCLWGWCRWRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C=CN=N2 |
Computed by PubChem (NCBI)