CAS 1152940-72-1 appears in our catalog under these names: 2-(1H-Pyrazol-1-yl)isonicotinic acid, 2-(1H-Pyrazol-1-yl)pyridine-4-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 250mg, 1g.
2-pyrazol-1-ylpyridine-4-carboxylic acid (CAS 1152940-72-1) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 2-pyrazol-1-ylpyridine-4-carboxylic acid. InChIKey: QHJHUTXUTFOAJX-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-pyrazol-1-ylpyridine-4-carboxylic acid |
| InChIKey | QHJHUTXUTFOAJX-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)