CAS 335255-82-8 appears in our catalog under these names: 3-(1H-1,2,3-Triazol-1-yl)benzoic acid, 95%, 3-(1H-1,2,3-Triazol-1-yl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
3-(triazol-1-yl)benzoic acid (CAS 335255-82-8) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 3-(triazol-1-yl)benzoic acid. InChIKey: NDILQXVACSSLIV-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-(triazol-1-yl)benzoic acid |
| InChIKey | NDILQXVACSSLIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=CN=N2)C(=O)O |
Computed by PubChem (NCBI)