CAS 1779128-15-2 is the registry number for 1-(Pyridin-2-yl)-1h-imidazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-pyridin-2-ylimidazole-4-carboxylic acid (CAS 1779128-15-2) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 3-pyridin-2-ylimidazole-4-carboxylic acid. InChIKey: ZGIMCHRETPQPNW-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-pyridin-2-ylimidazole-4-carboxylic acid |
| InChIKey | ZGIMCHRETPQPNW-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N2C=NC=C2C(=O)O |
Computed by PubChem (NCBI)