cas: 3696-22-8 — see every product listed under this CAS number, including other names
1-(4-Nitrophenyl)-2-thiourea (CAS 3696-22-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018922-100MG |
| cas | 3696-22-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 25g | 2892.75 Pln |
| delivery time | 3-4 weeks |
|---|
(4-nitrophenyl)thiourea (CAS 3696-22-8) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: (4-nitrophenyl)thiourea. InChIKey: BLYAANPIHFKKMQ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | (4-nitrophenyl)thiourea |
| InChIKey | BLYAANPIHFKKMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=S)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)