cas: 3696-22-8 — see every product listed under this CAS number, including other names
1-(4-Nitrophenyl)thiourea 98% (CAS 3696-22-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A775656-5g |
| cas | 3696-22-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 1087.94 Pln | |
| Ambeed | 100g | 3324.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A775656 |
(4-nitrophenyl)thiourea (CAS 3696-22-8) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: (4-nitrophenyl)thiourea. InChIKey: BLYAANPIHFKKMQ-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | (4-nitrophenyl)thiourea |
| InChIKey | BLYAANPIHFKKMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=S)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)