cas: 546107-39-5 — see every product listed under this CAS number, including other names
1-(4-ethylpiperazin-1-yl)-2-(4-nitrophenyl)ethan-1-one (CAS 546107-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EUM-1g |
| cas | 546107-39-5 |
| size | 1g |
| availability | 7.72g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4566.80 Pln |
| delivery time | 3 weeks |
|---|
1-(4-ethylpiperazin-1-yl)-2-(4-nitrophenyl)ethanone (CAS 546107-39-5) is a chemical compound with the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. IUPAC name: 1-(4-ethylpiperazin-1-yl)-2-(4-nitrophenyl)ethanone. InChIKey: HQXICBNBENMSEE-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O3 |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | 1-(4-ethylpiperazin-1-yl)-2-(4-nitrophenyl)ethanone |
| InChIKey | HQXICBNBENMSEE-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C(=O)CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)