CAS 1374651-40-7 is the registry number for 7-Amino-4-boc-4,5-dihydro-1h-benzo[e][1,4]diazepin-2(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 7-amino-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate (CAS 1374651-40-7) is a chemical compound with the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. IUPAC name: tert-butyl 7-amino-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate. InChIKey: BGZBMPGQAKCTPO-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O3 |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | tert-butyl 7-amino-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate |
| InChIKey | BGZBMPGQAKCTPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C=CC(=C2)N)NC(=O)C1 |
Computed by PubChem (NCBI)