Products 85126-73-4

CAS 85126-73-4 is the registry number for Methyl 4-[(piperazin-1-ylacetyl)amino]benzoate dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Methyl 4-[(2-piperazin-1-ylacetyl)amino]benzoate (CAS 85126-73-4) is a chemical compound with the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. IUPAC name: methyl 4-[(2-piperazin-1-ylacetyl)amino]benzoate. InChIKey: GNKBRGHNZZUWND-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19N3O3
Molecular weight277.32 g/mol
IUPAC namemethyl 4-[(2-piperazin-1-ylacetyl)amino]benzoate
InChIKeyGNKBRGHNZZUWND-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)NC(=O)CN2CCNCC2

Computed by PubChem (NCBI)