Products 1396968-12-9

CAS 1396968-12-9 is the registry number for 3-Hydrazinocarbonyl-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 3-(hydrazinecarbonyl)piperidine-1-carboxylate (CAS 1396968-12-9) is a chemical compound with the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. IUPAC name: benzyl 3-(hydrazinecarbonyl)piperidine-1-carboxylate. InChIKey: ULGPUXTZOOUIMA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19N3O3
Molecular weight277.32 g/mol
IUPAC namebenzyl 3-(hydrazinecarbonyl)piperidine-1-carboxylate
InChIKeyULGPUXTZOOUIMA-UHFFFAOYSA-N
SMILESC1CC(CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)NN

Computed by PubChem (NCBI)