CAS 1039726-83-4 is the registry number for N-[(4-Phenylpiperazin-1-yl)carbonyl]-l-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S)-2-[(4-phenylpiperazine-1-carbonyl)amino]propanoic acid (CAS 1039726-83-4) is a chemical compound with the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. IUPAC name: (2S)-2-[(4-phenylpiperazine-1-carbonyl)amino]propanoic acid. InChIKey: ZQGRWLKXGZLZNB-NSHDSACASA-N.
| Molecular formula | C14H19N3O3 |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | (2S)-2-[(4-phenylpiperazine-1-carbonyl)amino]propanoic acid |
| InChIKey | ZQGRWLKXGZLZNB-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)N1CCN(CC1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)