Products 698346-53-1

CAS 698346-53-1 is the registry number for 5-Oxo-5-(4-pyridin-2-ylpiperazin-1-yl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-oxo-5-(4-pyridin-2-ylpiperazin-1-yl)pentanoic acid (CAS 698346-53-1) is a chemical compound with the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. IUPAC name: 5-oxo-5-(4-pyridin-2-ylpiperazin-1-yl)pentanoic acid. InChIKey: VWJSKYWONUUYBB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19N3O3
Molecular weight277.32 g/mol
IUPAC name5-oxo-5-(4-pyridin-2-ylpiperazin-1-yl)pentanoic acid
InChIKeyVWJSKYWONUUYBB-UHFFFAOYSA-N
SMILESC1CN(CCN1C2=CC=CC=N2)C(=O)CCCC(=O)O

Computed by PubChem (NCBI)