1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone, 96%
cas: 617706-15-7 — see every product listed under this CAS number, including other names
1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone, 96% (CAS 617706-15-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A744488-100mg |
| cas | 617706-15-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1021.19 Pln | |
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1749.20 Pln | |
| Chemat | 5g | 5958.80 Pln | |
| Chemat | 10g | 9491.60 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1097.42 Pln | |
| BLDpharm | 5g | 3152.25 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone (CAS 617706-15-7) is a chemical compound with the molecular formula C8H3BrF4O and a molecular weight of 271.01 g/mol. IUPAC name: 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: DBEXLGFRBKOYBI-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O |
|---|---|
| Molecular weight | 271.01 g/mol |
| IUPAC name | 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | DBEXLGFRBKOYBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)
Synonyms:
1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethan-1-one, 1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone, 5'-Bromo-2,2,2,2'-tetrafluoroacetophenone, 1-(5-bromo-2-fluoro-phenyl)-2,2,2-trifluoro-ethanone, 5'-Bromo-2,2,2,2'-tetrafluoroacetophenone95%, 5'-Bromo-2,2,2,2'-tetrafluoroacetophenone 95%, Ethanone, 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoro-, 1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone - [B93496]