Products 1414870-67-9
CAS 1414870-67-9 appears in our catalog under these names: 4-Bromo-2-fluoro-5-(trifluoromethyl)benzaldehyde, 95%, 4-Bromo-2-fluoro-5-(trifluoromethyl)benzaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g.
4-bromo-2-fluoro-5-(trifluoromethyl)benzaldehyde (CAS 1414870-67-9) is a chemical compound with the molecular formula C8H3BrF4O and a molecular weight of 271.01 g/mol. IUPAC name: 4-bromo-2-fluoro-5-(trifluoromethyl)benzaldehyde. InChIKey: SYXXJSLVINTBHO-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O |
|---|---|
| Molecular weight | 271.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-(trifluoromethyl)benzaldehyde |
| InChIKey | SYXXJSLVINTBHO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(F)(F)F)Br)F)C=O |
Computed by PubChem (NCBI)