Products 1824139-62-9
CAS 1824139-62-9 is the registry number for 6-Bromo-2,2,3,3-tetrafluoro-2,3-dihydrobenzofuran. Offered by: TRC. Available pack sizes: 100mg.
6-bromo-2,2,3,3-tetrafluoro-1-benzofuran (CAS 1824139-62-9) is a chemical compound with the molecular formula C8H3BrF4O and a molecular weight of 271.01 g/mol. IUPAC name: 6-bromo-2,2,3,3-tetrafluoro-1-benzofuran. InChIKey: PTZSUVQTFDVLNL-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O |
|---|---|
| Molecular weight | 271.01 g/mol |
| IUPAC name | 6-bromo-2,2,3,3-tetrafluoro-1-benzofuran |
| InChIKey | PTZSUVQTFDVLNL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(C2(F)F)(F)F |
Computed by PubChem (NCBI)