CAS 617706-15-7 appears in our catalog under these names: 1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone, 98%, 1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone 96%, 1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone, 96%, 96%, 1-(5-Bromo-2-fluoro-phenyl)-2,2,2-trifluoro-ethanone. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone (CAS 617706-15-7) is a chemical compound with the molecular formula C8H3BrF4O and a molecular weight of 271.01 g/mol. IUPAC name: 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: DBEXLGFRBKOYBI-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O |
|---|---|
| Molecular weight | 271.01 g/mol |
| IUPAC name | 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | DBEXLGFRBKOYBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)