CAS 150698-74-1 appears in our catalog under these names: 1-(3-Bromo-4-fluoro-phenyl)-2,2,2-trifluoro-ethanone, 95%, 1-(3-Bromo-4-fluorophenyl)-2,2,2-trifluoroethanone, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
1-(3-bromo-4-fluorophenyl)-2,2,2-trifluoroethanone (CAS 150698-74-1) is a chemical compound with the molecular formula C8H3BrF4O and a molecular weight of 271.01 g/mol. IUPAC name: 1-(3-bromo-4-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: SFVGYPOXYKGQCG-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O |
|---|---|
| Molecular weight | 271.01 g/mol |
| IUPAC name | 1-(3-bromo-4-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | SFVGYPOXYKGQCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)(F)F)Br)F |
Computed by PubChem (NCBI)