CAS 871353-32-1 appears in our catalog under these names: 1-(3-Bromo-2-fluorophenyl)-2,2,2-trifluoroethan-1-one, 95%, 1-(3-Bromo-2-fluorophenyl)-2,2,2-trifluoroethan-1-one, 98%, 3'-Bromo-2,2,2,2'-tetrafluoroacetophenone, 1-(3-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanone, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
1-(3-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone (CAS 871353-32-1) is a chemical compound with the molecular formula C8H3BrF4O and a molecular weight of 271.01 g/mol. IUPAC name: 1-(3-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone. InChIKey: WZYRDTLSYWHILE-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF4O |
|---|---|
| Molecular weight | 271.01 g/mol |
| IUPAC name | 1-(3-bromo-2-fluorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | WZYRDTLSYWHILE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)