cas: 51501-31-6 — see every product listed under this CAS number, including other names
1-(7-Aminoindolin-1-yl)ethanone, 95%, 95% (CAS 51501-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117VRH-250mg |
| cas | 51501-31-6 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 875.60 Pln | |
| Chemat | 5g | 2531.60 Pln | |
| Chemat | 10g | 4470.80 Pln | |
| Chemat | 25g | 8704.40 Pln | |
| Chemat | 100mg | 222.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(7-amino-2,3-dihydroindol-1-yl)ethanone (CAS 51501-31-6) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1-(7-amino-2,3-dihydroindol-1-yl)ethanone. InChIKey: ZFSYJCQFOKJSFE-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(7-amino-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | ZFSYJCQFOKJSFE-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C(=CC=C2)N |
Computed by PubChem (NCBI)