cas: 846038-18-4 — see every product listed under this CAS number, including other names
1-(Benzo[b]thiophen-4-yl)piperazine, 98%, 98% (CAS 846038-18-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0E9-10g |
| cas | 846038-18-4 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 429.20 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 880.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(1-benzothiophen-4-yl)piperazine (CAS 846038-18-4) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 1-(1-benzothiophen-4-yl)piperazine. InChIKey: VMIRJNDPLCQEHB-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 1-(1-benzothiophen-4-yl)piperazine |
| InChIKey | VMIRJNDPLCQEHB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C=CSC3=CC=C2 |
Computed by PubChem (NCBI)