cas: 846038-18-4 — see every product listed under this CAS number, including other names
1-(Benzo[b]thiophen-4-yl)piperazine, 98% (CAS 846038-18-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F516392-1G |
| cas | 846038-18-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 315.53 Pln | |
| Fluorochem | 10g | 570.65 Pln | |
| Fluorochem | 25g | 1341.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(1-benzothiophen-4-yl)piperazine (CAS 846038-18-4) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 1-(1-benzothiophen-4-yl)piperazine. InChIKey: VMIRJNDPLCQEHB-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 1-(1-benzothiophen-4-yl)piperazine |
| InChIKey | VMIRJNDPLCQEHB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C=CSC3=CC=C2 |
Computed by PubChem (NCBI)