cas: 202737-28-8 — see every product listed under this CAS number, including other names
1-(Benzo[d][1,3]dioxol-5-yl)cyclobutane-1-carboxylic acid (CAS 202737-28-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F701358-100MG |
| cas | 202737-28-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 3278.03 Pln | |
| Fluorochem | 250mg | 4590.07 Pln |
| delivery time | 3-4 weeks |
|---|
1-(1,3-benzodioxol-5-yl)cyclobutane-1-carboxylic acid (CAS 202737-28-8) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)cyclobutane-1-carboxylic acid. InChIKey: HMFWQYJNPXGQTK-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)cyclobutane-1-carboxylic acid |
| InChIKey | HMFWQYJNPXGQTK-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC3=C(C=C2)OCO3)C(=O)O |
Computed by PubChem (NCBI)