Products 15231-78-4
CAS 15231-78-4 appears in our catalog under these names: 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione, 97%, 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione, 98%, 2，2–Dimethyl–5–phenyl–1，3–dioxane–4，6–dione, 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione, >98.0%(HPLC)(T), 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione 97%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg.
2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS 15231-78-4) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione. InChIKey: NTUAHNQWHPQAMB-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione |
| InChIKey | NTUAHNQWHPQAMB-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)