CAS 53229-58-6 appears in our catalog under these names: (1S,2R)-Rel-2-[(benzyloxy)carbonyl]cyclopropane-1-carboxylic acid, 95%, (1S,2R)-2-Benzyloxycarbonylcyclopropanecarboxylic acid, 95%, cis-2-((Benzyloxy)carbonyl)cyclopropanecarboxylic acid, 98%, 98%, (1S,2R)-rel-2-[(benzyloxy)carbonyl]cyclopropane-1-carboxylic acid, 9500%, cis-2-((Benzyloxy)carbonyl)cyclopropanecarboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
Cis-(1S,2R)-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid (CAS 53229-58-6) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: cis-(1S,2R)-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: PVARIGOXRLDYSP-VHSXEESVSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | cis-(1S,2R)-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | PVARIGOXRLDYSP-VHSXEESVSA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)