Products 202737-28-8

CAS 202737-28-8 is the registry number for 1-(1,3-Benzodioxol-5-yl)cyclobutanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(1,3-benzodioxol-5-yl)cyclobutane-1-carboxylic acid (CAS 202737-28-8) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)cyclobutane-1-carboxylic acid. InChIKey: HMFWQYJNPXGQTK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O4
Molecular weight220.22 g/mol
IUPAC name1-(1,3-benzodioxol-5-yl)cyclobutane-1-carboxylic acid
InChIKeyHMFWQYJNPXGQTK-UHFFFAOYSA-N
SMILESC1CC(C1)(C2=CC3=C(C=C2)OCO3)C(=O)O

Computed by PubChem (NCBI)