CAS 53229-64-4 appears in our catalog under these names: Trans-1,2-cyclopropanedicarboylic acid, mono(phenylmethyl) ester, 95%, Rel–(1R,2R)–2–((benzyloxy)carbonyl)cyclopropane–1–carboxylic acid, Rel-(1R,2R)-2-((benzyloxy)carbonyl)cyclopropane-1-carboxylic acid, 95%, 95%, Rel-(1R,2R)-2-((benzyloxy)carbonyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
Trans-(1R,2R)-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid (CAS 53229-64-4) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: trans-(1R,2R)-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: PVARIGOXRLDYSP-NXEZZACHSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | trans-(1R,2R)-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | PVARIGOXRLDYSP-NXEZZACHSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)