CAS 1094253-79-8 appears in our catalog under these names: 7-Methoxy-3,5-dimethyl-1-benzofuran-2-carboxylic acid, 95%, 7-Methoxy-3,5-dimethyl-1-benzofuran-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
7-methoxy-3,5-dimethyl-1-benzofuran-2-carboxylic acid (CAS 1094253-79-8) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 7-methoxy-3,5-dimethyl-1-benzofuran-2-carboxylic acid. InChIKey: RRQSBMXZRNEZME-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 7-methoxy-3,5-dimethyl-1-benzofuran-2-carboxylic acid |
| InChIKey | RRQSBMXZRNEZME-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)OC)OC(=C2C)C(=O)O |
Computed by PubChem (NCBI)