cas: 176175-97-6 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-3,5-difluorobenzene (CAS 176175-97-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232883-1G |
| cas | 176175-97-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 3392.57 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-difluoro-5-phenylmethoxybenzene (CAS 176175-97-6) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: 1,3-difluoro-5-phenylmethoxybenzene. InChIKey: PEDMGHKJUCZTHB-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | 1,3-difluoro-5-phenylmethoxybenzene |
| InChIKey | PEDMGHKJUCZTHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)