CAS 1416439-94-5 appears in our catalog under these names: (3',4'-Difluoro-[1,1'-biphenyl]-2-yl)methanol, 95%, (3',4'-Difluoro-(1,1'-biphenyl)-2-yl)methanol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[2-(3,4-difluorophenyl)phenyl]methanol (CAS 1416439-94-5) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: [2-(3,4-difluorophenyl)phenyl]methanol. InChIKey: KYNAJAPXJUWEPH-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | [2-(3,4-difluorophenyl)phenyl]methanol |
| InChIKey | KYNAJAPXJUWEPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)