cas: 176175-97-6 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-3,5-difluorobenzene, 97% (CAS 176175-97-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A628268-5g |
| cas | 176175-97-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6163.36 Pln | |
| AmBeed | 10g | 7445.83 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-difluoro-5-phenylmethoxybenzene (CAS 176175-97-6) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: 1,3-difluoro-5-phenylmethoxybenzene. InChIKey: PEDMGHKJUCZTHB-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | 1,3-difluoro-5-phenylmethoxybenzene |
| InChIKey | PEDMGHKJUCZTHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)